Products 1285121-04-1

CAS 1285121-04-1 is the registry number for 5-Chloro-2-(oxolan-3-ylmethoxy)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

5-chloro-2-(oxolan-3-ylmethoxy)benzenesulfonyl chloride (CAS 1285121-04-1) is a chemical compound with the molecular formula C11H12Cl2O4S and a molecular weight of 311.2 g/mol. IUPAC name: 5-chloro-2-(oxolan-3-ylmethoxy)benzenesulfonyl chloride. InChIKey: ZGEHGWISCKCNTK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12Cl2O4S
Molecular weight311.2 g/mol
IUPAC name5-chloro-2-(oxolan-3-ylmethoxy)benzenesulfonyl chloride
InChIKeyZGEHGWISCKCNTK-UHFFFAOYSA-N
SMILESC1COCC1COC2=C(C=C(C=C2)Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)