CAS 1285121-04-1 is the registry number for 5-Chloro-2-(oxolan-3-ylmethoxy)benzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5-chloro-2-(oxolan-3-ylmethoxy)benzenesulfonyl chloride (CAS 1285121-04-1) is a chemical compound with the molecular formula C11H12Cl2O4S and a molecular weight of 311.2 g/mol. IUPAC name: 5-chloro-2-(oxolan-3-ylmethoxy)benzenesulfonyl chloride. InChIKey: ZGEHGWISCKCNTK-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2O4S |
|---|---|
| Molecular weight | 311.2 g/mol |
| IUPAC name | 5-chloro-2-(oxolan-3-ylmethoxy)benzenesulfonyl chloride |
| InChIKey | ZGEHGWISCKCNTK-UHFFFAOYSA-N |
| SMILES | C1COCC1COC2=C(C=C(C=C2)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)