CAS 1285160-89-5 appears in our catalog under these names: 2-Bromo-1-N-(2,4-difluorophenyl)benzene-1,4-diamine, 95%, 2-Bromo-1-N-(2,4-difluorophenyl)benzene-1,4-diamine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-bromo-1-N-(2,4-difluorophenyl)benzene-1,4-diamine (CAS 1285160-89-5) is a chemical compound with the molecular formula C12H9BrF2N2 and a molecular weight of 299.11 g/mol. IUPAC name: 2-bromo-1-N-(2,4-difluorophenyl)benzene-1,4-diamine. InChIKey: ZORIOODRBDTNCH-UHFFFAOYSA-N.
| Molecular formula | C12H9BrF2N2 |
|---|---|
| Molecular weight | 299.11 g/mol |
| IUPAC name | 2-bromo-1-N-(2,4-difluorophenyl)benzene-1,4-diamine |
| InChIKey | ZORIOODRBDTNCH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Br)NC2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)