CAS 1285515-21-0 appears in our catalog under these names: GSK2578215A/ 99.81% (existing batch purity), GSK2578215A, GSK2578215A 98%, GSK2578215A, 98%, 98%, GSK2578215A, 99.82%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 1mg.
5-(2-fluoro-4-pyridinyl)-2-phenylmethoxy-N-pyridin-3-ylbenzamide (CAS 1285515-21-0) is a chemical compound with the molecular formula C24H18FN3O2 and a molecular weight of 399.4 g/mol. IUPAC name: 5-(2-fluoro-4-pyridinyl)-2-phenylmethoxy-N-pyridin-3-ylbenzamide. InChIKey: WCIGMFCFPXZRMQ-UHFFFAOYSA-N.
| Molecular formula | C24H18FN3O2 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 5-(2-fluoro-4-pyridinyl)-2-phenylmethoxy-N-pyridin-3-ylbenzamide |
| InChIKey | WCIGMFCFPXZRMQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C3=CC(=NC=C3)F)C(=O)NC4=CN=CC=C4 |
Computed by PubChem (NCBI)