CAS 128585-01-3 appears in our catalog under these names: Ospemifene Impurity 1, 4-Hydroxy Ospemifene (Ospemifene Impurity), >95% (HPLC). Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg.
4-[(Z)-4-chloro-1-[4-(2-hydroxyethoxy)phenyl]-2-phenylbut-1-enyl]phenol (CAS 128585-01-3) is a chemical compound with the molecular formula C24H23ClO3 and a molecular weight of 394.9 g/mol. IUPAC name: 4-[(Z)-4-chloro-1-[4-(2-hydroxyethoxy)phenyl]-2-phenylbut-1-enyl]phenol. InChIKey: ISISSTPNAJAQFE-VHXPQNKSSA-N.
| Molecular formula | C24H23ClO3 |
|---|---|
| Molecular weight | 394.9 g/mol |
| IUPAC name | 4-[(Z)-4-chloro-1-[4-(2-hydroxyethoxy)phenyl]-2-phenylbut-1-enyl]phenol |
| InChIKey | ISISSTPNAJAQFE-VHXPQNKSSA-N |
| SMILES | C1=CC=C(C=C1)/C(=C(/C2=CC=C(C=C2)O)\C3=CC=C(C=C3)OCCO)/CCCl |
Computed by PubChem (NCBI)