Products 1285918-53-7
CAS 1285918-53-7 appears in our catalog under these names: Reboxetine-d5 Mesylate, >95% (HPLC), Reboxetine–d5 mesylate, Reboxetine-d5 (mesylate), 95.0%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 2.5 mg.
Methanesulfonic acid;(2R)-2-[(R)-[2-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]-phenylmethyl]morpholine (CAS 1285918-53-7) is a chemical compound with the molecular formula C20H27NO6S and a molecular weight of 414.5 g/mol. IUPAC name: methanesulfonic acid;(2R)-2-[(R)-[2-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]-phenylmethyl]morpholine. InChIKey: CGTZMJIMMUNLQD-HODPIWSTSA-N.
| Molecular formula | C20H27NO6S |
|---|---|
| Molecular weight | 414.5 g/mol |
| IUPAC name | methanesulfonic acid;(2R)-2-[(R)-[2-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]-phenylmethyl]morpholine |
| InChIKey | CGTZMJIMMUNLQD-HODPIWSTSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=CC=CC=C1O[C@@H]([C@H]2CNCCO2)C3=CC=CC=C3.CS(=O)(=O)O |
Computed by PubChem (NCBI)