Products 1286117-65-4
CAS 1286117-65-4 is the registry number for 10-Hydroxy Warfarin-d5(Mixture of Diastereomers). Offered by: TRC. Available pack sizes: 25mg.
4-hydroxy-3-[2-hydroxy-3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one (CAS 1286117-65-4) is a chemical compound with the molecular formula C19H16O5 and a molecular weight of 329.4 g/mol. IUPAC name: 4-hydroxy-3-[2-hydroxy-3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one. InChIKey: BPZSPAZBZFZZBN-ATTUOBAHSA-N.
| Molecular formula | C19H16O5 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 4-hydroxy-3-[2-hydroxy-3-oxo-1-(2,3,4,5,6-pentadeuteriophenyl)butyl]chromen-2-one |
| InChIKey | BPZSPAZBZFZZBN-ATTUOBAHSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C2=C(C3=CC=CC=C3OC2=O)O)C(C(=O)C)O)[2H])[2H] |
Computed by PubChem (NCBI)