Products 1286126-67-7
CAS 1286126-67-7 appears in our catalog under these names: Diltiazem EP Impurity C, Diltiazem EP Impurity C HCl (O-Desmethyl Diltiazem HCl), Diltiazem Impurity 3（Diltiazem EP Impurity C）. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate;hydrochloride (CAS 1286126-67-7) is a chemical compound with the molecular formula C21H25ClN2O4S and a molecular weight of 437.0 g/mol. IUPAC name: [(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate;hydrochloride. InChIKey: ZNPGBHQQNJBDCH-FDOHDBATSA-N.
| Molecular formula | C21H25ClN2O4S |
|---|---|
| Molecular weight | 437.0 g/mol |
| IUPAC name | [(2S,3S)-5-[2-(dimethylamino)ethyl]-2-(4-hydroxyphenyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl] acetate;hydrochloride |
| InChIKey | ZNPGBHQQNJBDCH-FDOHDBATSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](SC2=CC=CC=C2N(C1=O)CCN(C)C)C3=CC=C(C=C3)O.Cl |
Computed by PubChem (NCBI)