CAS 1286131-38-1 is the registry number for Dibromocyanoacetamide-13C3. Offered by: TRC. Available pack sizes: 10mg, 1mg.
2-(azanylidyne(113C)methyl)-2,2-dibromoacetamide (CAS 1286131-38-1) is a chemical compound with the molecular formula C3H2Br2N2O and a molecular weight of 244.85 g/mol. IUPAC name: 2-(azanylidyne(113C)methyl)-2,2-dibromoacetamide. InChIKey: UUIVKBHZENILKB-VMIGTVKRSA-N.
| Molecular formula | C3H2Br2N2O |
|---|---|
| Molecular weight | 244.85 g/mol |
| IUPAC name | 2-(azanylidyne(113C)methyl)-2,2-dibromoacetamide |
| InChIKey | UUIVKBHZENILKB-VMIGTVKRSA-N |
| SMILES | [13C](#N)[13C]([13C](=O)N)(Br)Br |
Computed by PubChem (NCBI)