CAS 1286207-78-0 appears in our catalog under these names: (R)-tert-Butyl 3-(5-aminopyridin-2-yloxy)pyrrolidine-1-carboxylate, 95%, (R)-tert-Butyl 3-(5-aminopyridin-2-yloxy)pyrrolidine-1-carboxylate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 0,5g, 50mg.
Tert-butyl (3R)-3-[(5-amino-2-pyridinyl)oxy]pyrrolidine-1-carboxylate (CAS 1286207-78-0) is a chemical compound with the molecular formula C14H21N3O3 and a molecular weight of 279.33 g/mol. IUPAC name: tert-butyl (3R)-3-[(5-amino-2-pyridinyl)oxy]pyrrolidine-1-carboxylate. InChIKey: PRDVDKXXIRYCAA-LLVKDONJSA-N.
| Molecular formula | C14H21N3O3 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | tert-butyl (3R)-3-[(5-amino-2-pyridinyl)oxy]pyrrolidine-1-carboxylate |
| InChIKey | PRDVDKXXIRYCAA-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)OC2=NC=C(C=C2)N |
Computed by PubChem (NCBI)