CAS 1286208-73-8 appears in our catalog under these names: (R)-1-(4-Bromobenzyl)pyrrolidin-3-aminedihydrochloride, 95%, (R)-1-(4-Bromobenzyl)pyrrolidin-3-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(3R)-1-[(4-bromophenyl)methyl]pyrrolidin-3-amine;dihydrochloride (CAS 1286208-73-8) is a chemical compound with the molecular formula C11H17BrCl2N2 and a molecular weight of 328.07 g/mol. IUPAC name: (3R)-1-[(4-bromophenyl)methyl]pyrrolidin-3-amine;dihydrochloride. InChIKey: JIXOPTKQXMLVRF-NVJADKKVSA-N.
| Molecular formula | C11H17BrCl2N2 |
|---|---|
| Molecular weight | 328.07 g/mol |
| IUPAC name | (3R)-1-[(4-bromophenyl)methyl]pyrrolidin-3-amine;dihydrochloride |
| InChIKey | JIXOPTKQXMLVRF-NVJADKKVSA-N |
| SMILES | C1CN(C[C@@H]1N)CC2=CC=C(C=C2)Br.Cl.Cl |
Computed by PubChem (NCBI)