CAS 1286208-87-4 appears in our catalog under these names: (R)-N-[(4-Bromophenyl)methyl]piperidin-3-amine dihydrochloride, 95%, (R)-N-(4-Bromobenzyl)piperidin-3-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(3R)-N-[(4-bromophenyl)methyl]piperidin-3-amine;dihydrochloride (CAS 1286208-87-4) is a chemical compound with the molecular formula C12H19BrCl2N2 and a molecular weight of 342.10 g/mol. IUPAC name: (3R)-N-[(4-bromophenyl)methyl]piperidin-3-amine;dihydrochloride. InChIKey: ZCUZMBOLTCNPCA-CURYUGHLSA-N.
| Molecular formula | C12H19BrCl2N2 |
|---|---|
| Molecular weight | 342.10 g/mol |
| IUPAC name | (3R)-N-[(4-bromophenyl)methyl]piperidin-3-amine;dihydrochloride |
| InChIKey | ZCUZMBOLTCNPCA-CURYUGHLSA-N |
| SMILES | C1C[C@H](CNC1)NCC2=CC=C(C=C2)Br.Cl.Cl |
Computed by PubChem (NCBI)