CAS 1286265-62-0 is the registry number for 1-(3-Fluoro-5-methylbenzyl)piperidin-4-amine dihydrochloride, 97%. Offered by: AmBeed. Available pack sizes: 1g.
1-[(3-fluoro-5-methylphenyl)methyl]piperidin-4-amine;dihydrochloride (CAS 1286265-62-0) is a chemical compound with the molecular formula C13H21Cl2FN2 and a molecular weight of 295.22 g/mol. IUPAC name: 1-[(3-fluoro-5-methylphenyl)methyl]piperidin-4-amine;dihydrochloride. InChIKey: FIIKXOZZYXLJQK-UHFFFAOYSA-N.
| Molecular formula | C13H21Cl2FN2 |
|---|---|
| Molecular weight | 295.22 g/mol |
| IUPAC name | 1-[(3-fluoro-5-methylphenyl)methyl]piperidin-4-amine;dihydrochloride |
| InChIKey | FIIKXOZZYXLJQK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)F)CN2CCC(CC2)N.Cl.Cl |
Computed by PubChem (NCBI)