CAS 1286273-19-5 is the registry number for tert-Butyl 4-(4-(methoxycarbonyl)phenylsulfonamido)piperidine-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 4-[(4-methoxycarbonylphenyl)sulfonylamino]piperidine-1-carboxylate (CAS 1286273-19-5) is a chemical compound with the molecular formula C18H26N2O6S and a molecular weight of 398.5 g/mol. IUPAC name: tert-butyl 4-[(4-methoxycarbonylphenyl)sulfonylamino]piperidine-1-carboxylate. InChIKey: HLSJNCXRRJEOQJ-UHFFFAOYSA-N.
| Molecular formula | C18H26N2O6S |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | tert-butyl 4-[(4-methoxycarbonylphenyl)sulfonylamino]piperidine-1-carboxylate |
| InChIKey | HLSJNCXRRJEOQJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NS(=O)(=O)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)