CAS 1286273-29-7 appears in our catalog under these names: 1-(3,4,5-Trifluorobenzyl)piperidin-4-amine dihydrochloride, 95%, 1-(3,4,5-Trifluorobenzyl)piperidin-4-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
1-[(3,4,5-trifluorophenyl)methyl]piperidin-4-amine;dihydrochloride (CAS 1286273-29-7) is a chemical compound with the molecular formula C12H17Cl2F3N2 and a molecular weight of 317.17 g/mol. IUPAC name: 1-[(3,4,5-trifluorophenyl)methyl]piperidin-4-amine;dihydrochloride. InChIKey: MKSIQIKBVZXGDE-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl2F3N2 |
|---|---|
| Molecular weight | 317.17 g/mol |
| IUPAC name | 1-[(3,4,5-trifluorophenyl)methyl]piperidin-4-amine;dihydrochloride |
| InChIKey | MKSIQIKBVZXGDE-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)CC2=CC(=C(C(=C2)F)F)F.Cl.Cl |
Computed by PubChem (NCBI)