CAS 1286274-81-4 appears in our catalog under these names: (4-Aminopiperidin-1-yl)(3-bromophenyl)methanone hydrochloride, 95%, (4-Aminopiperidin-1-yl)(3-bromophenyl)methanone hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
(4-aminopiperidin-1-yl)-(3-bromophenyl)methanone;hydrochloride (CAS 1286274-81-4) is a chemical compound with the molecular formula C12H16BrClN2O and a molecular weight of 319.62 g/mol. IUPAC name: (4-aminopiperidin-1-yl)-(3-bromophenyl)methanone;hydrochloride. InChIKey: PLNYNROWTOWACB-UHFFFAOYSA-N.
| Molecular formula | C12H16BrClN2O |
|---|---|
| Molecular weight | 319.62 g/mol |
| IUPAC name | (4-aminopiperidin-1-yl)-(3-bromophenyl)methanone;hydrochloride |
| InChIKey | PLNYNROWTOWACB-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C(=O)C2=CC(=CC=C2)Br.Cl |
Computed by PubChem (NCBI)