CAS 1286624-16-5 appears in our catalog under these names: N,N-Didesmethyl Trimebutine-d5 Hydrochloride, >95% (HPLC), N,N-Didesmethyl trimebutine-d5 (hydrochloride). Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
(2-amino-3,3,4,4,4-pentadeuterio-2-phenylbutyl) 3,4,5-trimethoxybenzoate;hydrochloride (CAS 1286624-16-5) is a chemical compound with the molecular formula C20H26ClNO5 and a molecular weight of 400.9 g/mol. IUPAC name: (2-amino-3,3,4,4,4-pentadeuterio-2-phenylbutyl) 3,4,5-trimethoxybenzoate;hydrochloride. InChIKey: NOKRVDGVOIZAKJ-PAJIIYFZSA-N.
| Molecular formula | C20H26ClNO5 |
|---|---|
| Molecular weight | 400.9 g/mol |
| IUPAC name | (2-amino-3,3,4,4,4-pentadeuterio-2-phenylbutyl) 3,4,5-trimethoxybenzoate;hydrochloride |
| InChIKey | NOKRVDGVOIZAKJ-PAJIIYFZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(COC(=O)C1=CC(=C(C(=C1)OC)OC)OC)(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)