CAS 1286708-64-2 is the registry number for 3-(3-(Thiophen-2-yl)-1,2,4-oxadiazol-5-yl)propan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride (CAS 1286708-64-2) is a chemical compound with the molecular formula C9H12ClN3OS and a molecular weight of 245.73 g/mol. IUPAC name: 3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride. InChIKey: NBVHUHYKJMFGDV-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3OS |
|---|---|
| Molecular weight | 245.73 g/mol |
| IUPAC name | 3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)propan-1-amine;hydrochloride |
| InChIKey | NBVHUHYKJMFGDV-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NOC(=N2)CCCN.Cl |
Computed by PubChem (NCBI)