CAS 1286737-75-4 appears in our catalog under these names: 7,9-Dimesityl-7H-acenaphtho[1,2-d]imidazol-9-ium chloride, 97%, 97%, 7,9-Dimesityl-7H-acenaphtho[1,2-d]imidazol-9-ium chloride, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
7,9-bis(2,4,6-trimethylphenyl)acenaphthyleno[1,2-d]imidazol-9-ium chloride (CAS 1286737-75-4) is a chemical compound with the molecular formula C31H29ClN2 and a molecular weight of 465.0 g/mol. IUPAC name: 7,9-bis(2,4,6-trimethylphenyl)acenaphthyleno[1,2-d]imidazol-9-ium chloride. InChIKey: MOYHJRBGZYOSFI-UHFFFAOYSA-M.
| Molecular formula | C31H29ClN2 |
|---|---|
| Molecular weight | 465.0 g/mol |
| IUPAC name | 7,9-bis(2,4,6-trimethylphenyl)acenaphthyleno[1,2-d]imidazol-9-ium chloride |
| InChIKey | MOYHJRBGZYOSFI-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)N2C=[N+](C3=C2C4=CC=CC5=C4C3=CC=C5)C6=C(C=C(C=C6C)C)C)C.[Cl-] |
Computed by PubChem (NCBI)