Products 1286761-84-9
CAS 1286761-84-9 is the registry number for (R)-2-Amino-3-(trifluoromethoxy)propanoic acid, 97%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
(2R)-2-amino-3-(trifluoromethoxy)propanoic acid (CAS 1286761-84-9) is a chemical compound with the molecular formula C4H6F3NO3 and a molecular weight of 173.09 g/mol. IUPAC name: (2R)-2-amino-3-(trifluoromethoxy)propanoic acid. InChIKey: BGDJXHSDJCFWPX-UWTATZPHSA-N.
| Molecular formula | C4H6F3NO3 |
|---|---|
| Molecular weight | 173.09 g/mol |
| IUPAC name | (2R)-2-amino-3-(trifluoromethoxy)propanoic acid |
| InChIKey | BGDJXHSDJCFWPX-UWTATZPHSA-N |
| SMILES | C([C@H](C(=O)O)N)OC(F)(F)F |
Computed by PubChem (NCBI)