CAS 1286793-00-7 is the registry number for 5,7-Dichloro-3,3-difluoro-2,3-dihydroindole-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
5,7-dichloro-3,3-difluoro-1H-indol-2-one (CAS 1286793-00-7) is a chemical compound with the molecular formula C8H3Cl2F2NO and a molecular weight of 238.01 g/mol. IUPAC name: 5,7-dichloro-3,3-difluoro-1H-indol-2-one. InChIKey: CAQMRLLSTLZQKL-UHFFFAOYSA-N.
| Molecular formula | C8H3Cl2F2NO |
|---|---|
| Molecular weight | 238.01 g/mol |
| IUPAC name | 5,7-dichloro-3,3-difluoro-1H-indol-2-one |
| InChIKey | CAQMRLLSTLZQKL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(C(=O)N2)(F)F)Cl)Cl |
Computed by PubChem (NCBI)