Products 1286793-06-3
CAS 1286793-06-3 is the registry number for 5-Chloro-3,3-difluoro-1,3-dihydropyrrolo(2,3-b)pyridine-2- one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g.
5-chloro-3,3-difluoro-1H-pyrrolo[2,3-b]pyridin-2-one (CAS 1286793-06-3) is a chemical compound with the molecular formula C7H3ClF2N2O and a molecular weight of 204.56 g/mol. IUPAC name: 5-chloro-3,3-difluoro-1H-pyrrolo[2,3-b]pyridin-2-one. InChIKey: WFLGQBQJWFZQIL-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF2N2O |
|---|---|
| Molecular weight | 204.56 g/mol |
| IUPAC name | 5-chloro-3,3-difluoro-1H-pyrrolo[2,3-b]pyridin-2-one |
| InChIKey | WFLGQBQJWFZQIL-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(C(=O)N2)(F)F)Cl |
Computed by PubChem (NCBI)