CAS 1287-16-7 appears in our catalog under these names: Ferroceneacetic Acid, Ferroceneacetic Acid, Ferroceneacetic Acid, >97.0%(GC), Ferrocenylacetic acid 97%, (Carboxymethyl)ferrocene, 97%, 97%. Offered by: TRC, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 100mg, 1g, 500g, 10g, 200mg, 5g, 2g, 25g.
Cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylacetic acid;iron(2+) (CAS 1287-16-7) is a chemical compound with the molecular formula C12H12FeO2 and a molecular weight of 244.07 g/mol. IUPAC name: cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylacetic acid;iron(2+). InChIKey: MOUVOWJUMAKBBM-UHFFFAOYSA-N.
| Molecular formula | C12H12FeO2 |
|---|---|
| Molecular weight | 244.07 g/mol |
| IUPAC name | cyclopenta-1,3-diene;2-cyclopenta-1,3-dien-1-ylacetic acid;iron(2+) |
| InChIKey | MOUVOWJUMAKBBM-UHFFFAOYSA-N |
| SMILES | [CH-]1C=CC=C1.[CH-]1C=CC=C1CC(=O)O.[Fe+2] |
Computed by PubChem (NCBI)