Products 128700-84-5
CAS 128700-84-5 is the registry number for Lychnostatin 2. Offered by: MedChemExpress. Available pack sizes: Get quote.
Lychnostatin 2 is a cyclic ketone, an acetate ester and a germacranolide. It has a role as a metabolite and an antineoplastic agent.
Source: ChEBI
| Molecular formula | C21H28O7 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | [(3aS,4S,6R,10S,11aR)-6-acetyloxy-6,10-dimethyl-3-methylidene-2,7-dioxo-3a,4,5,8,9,10,11,11a-octahydrocyclodeca[b]furan-4-yl] 2-methylprop-2-enoate |
| InChIKey | HBRKQMNFEIZZOU-AGKHZPTMSA-N |
| SMILES | C[C@H]1CCC(=O)[C@](C[C@@H]([C@@H]2[C@@H](C1)OC(=O)C2=C)OC(=O)C(=C)C)(C)OC(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Lychnostatin 2, orb2663531