CAS 1287040-94-1 appears in our catalog under these names: Eletriptan-d3, Eletriptan-d3 HBr. Offered by: TRC, MedChemExpress, Hubei YoungXin. Available pack sizes: 25mg, 10 mg, 1 mg, 10mg, 50mg, 100mg, 200mg.
5-[2-(benzenesulfonyl)ethyl]-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole (CAS 1287040-94-1) is a chemical compound with the molecular formula C22H26N2O2S and a molecular weight of 385.5 g/mol. IUPAC name: 5-[2-(benzenesulfonyl)ethyl]-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole. InChIKey: PWVXXGRKLHYWKM-ZDRPVFGASA-N.
| Molecular formula | C22H26N2O2S |
|---|---|
| Molecular weight | 385.5 g/mol |
| IUPAC name | 5-[2-(benzenesulfonyl)ethyl]-3-[[(2R)-1-(trideuteriomethyl)pyrrolidin-2-yl]methyl]-1H-indole |
| InChIKey | PWVXXGRKLHYWKM-ZDRPVFGASA-N |
| SMILES | [2H]C([2H])([2H])N1CCC[C@@H]1CC2=CNC3=C2C=C(C=C3)CCS(=O)(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)