CAS 1287227-88-6 is the registry number for 3-(Dimethylamino)-1-(2-fluoro-1,1'-biphenyl-4-yl)prop-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-3-(dimethylamino)-1-(3-fluoro-4-phenylphenyl)prop-2-en-1-one (CAS 1287227-88-6) is a chemical compound with the molecular formula C17H16FNO and a molecular weight of 269.31 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-(3-fluoro-4-phenylphenyl)prop-2-en-1-one. InChIKey: NDFSJPDKGCMCOA-ZHACJKMWSA-N.
| Molecular formula | C17H16FNO |
|---|---|
| Molecular weight | 269.31 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-(3-fluoro-4-phenylphenyl)prop-2-en-1-one |
| InChIKey | NDFSJPDKGCMCOA-ZHACJKMWSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CC(=C(C=C1)C2=CC=CC=C2)F |
Computed by PubChem (NCBI)