CAS 128726-56-7 appears in our catalog under these names: Tolnaftate Impurity 7, N,N'-Dimethyl-N,N'-bis(3-methylphenyl)-thioperoxydicarbonic Diamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
[methyl-(3-methylphenyl)carbamothioyl]sulfanyl N-methyl-N-(3-methylphenyl)carbamodithioate (CAS 128726-56-7) is a chemical compound with the molecular formula C18H20N2S4 and a molecular weight of 392.6 g/mol. IUPAC name: [methyl-(3-methylphenyl)carbamothioyl]sulfanyl N-methyl-N-(3-methylphenyl)carbamodithioate. InChIKey: INAVZCOSJPPBDL-UHFFFAOYSA-N.
| Molecular formula | C18H20N2S4 |
|---|---|
| Molecular weight | 392.6 g/mol |
| IUPAC name | [methyl-(3-methylphenyl)carbamothioyl]sulfanyl N-methyl-N-(3-methylphenyl)carbamodithioate |
| InChIKey | INAVZCOSJPPBDL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C)C(=S)SSC(=S)N(C)C2=CC=CC(=C2)C |
Computed by PubChem (NCBI)