CAS 128731-75-9 appears in our catalog under these names: Octyl α-D-thioglucopyranoside, Octyl α-D-thioglucopyranoside, 50 mg, Octyl α-D-thioglucopyranoside, 100 mg, Octyl α-D-thioglucopyranoside, 250 mg, Octyl α-D-thioglucopyranoside, 500 mg. Offered by: Biosynth, Roth. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg, 1g.
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-octylsulfanyloxane-3,4,5-triol (CAS 128731-75-9) is a chemical compound with the molecular formula C14H28O5S and a molecular weight of 308.44 g/mol. IUPAC name: (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-octylsulfanyloxane-3,4,5-triol. InChIKey: CGVLVOOFCGWBCS-RKQHYHRCSA-N.
| Molecular formula | C14H28O5S |
|---|---|
| Molecular weight | 308.44 g/mol |
| IUPAC name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-octylsulfanyloxane-3,4,5-triol |
| InChIKey | CGVLVOOFCGWBCS-RKQHYHRCSA-N |
| SMILES | CCCCCCCCS[C@@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O |
Computed by PubChem (NCBI)