CAS 1287393-54-7 appears in our catalog under these names: Glycidyl Linolenate-d5, Glycidyl Linolenate-d5 (1.0 mg/mL in isopropanol), Linolenic acid glycidyl ester-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 1x1ml, 1 mg (2.95 mM * 1 mL in isopropanol).
[dideuterio-(2,3,3-trideuteriooxiran-2-yl)methyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate (CAS 1287393-54-7) is a chemical compound with the molecular formula C21H34O3 and a molecular weight of 339.5 g/mol. IUPAC name: [dideuterio-(2,3,3-trideuteriooxiran-2-yl)methyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate. InChIKey: SGFJJNBUMXQSMU-IMUSMWQLSA-N.
| Molecular formula | C21H34O3 |
|---|---|
| Molecular weight | 339.5 g/mol |
| IUPAC name | [dideuterio-(2,3,3-trideuteriooxiran-2-yl)methyl] (9Z,12Z,15Z)-octadeca-9,12,15-trienoate |
| InChIKey | SGFJJNBUMXQSMU-IMUSMWQLSA-N |
| SMILES | [2H]C1(C(O1)([2H])C([2H])([2H])OC(=O)CCCCCCC/C=C\C/C=C\C/C=C\CC)[2H] |
Computed by PubChem (NCBI)