CAS 1287753-38-1 appears in our catalog under these names: [4-Chloro-2-(3,5-dimethyl-1h-pyrazol-1-yl)phenyl]boronic acid, 95%, (4-Chloro-2-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl)boronic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 10g.
[4-chloro-2-(3,5-dimethylpyrazol-1-yl)phenyl]boronic acid (CAS 1287753-38-1) is a chemical compound with the molecular formula C11H12BClN2O2 and a molecular weight of 250.49 g/mol. IUPAC name: [4-chloro-2-(3,5-dimethylpyrazol-1-yl)phenyl]boronic acid. InChIKey: RHBQEOVZNHLSCQ-UHFFFAOYSA-N.
| Molecular formula | C11H12BClN2O2 |
|---|---|
| Molecular weight | 250.49 g/mol |
| IUPAC name | [4-chloro-2-(3,5-dimethylpyrazol-1-yl)phenyl]boronic acid |
| InChIKey | RHBQEOVZNHLSCQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)Cl)N2C(=CC(=N2)C)C)(O)O |
Computed by PubChem (NCBI)