Products 128805-94-7

CAS 128805-94-7 is the registry number for Ethyl 5-[[amino(imino)methyl]amino]-2-(benzoylamino)pentanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-benzamido-5-(diaminomethylideneamino)pentanoate;hydrochloride (CAS 128805-94-7) is a chemical compound with the molecular formula C15H23ClN4O3 and a molecular weight of 342.82 g/mol. IUPAC name: ethyl 2-benzamido-5-(diaminomethylideneamino)pentanoate;hydrochloride. InChIKey: HIXDELXKSSLIKB-UHFFFAOYSA-N.

Identity
Molecular formulaC15H23ClN4O3
Molecular weight342.82 g/mol
IUPAC nameethyl 2-benzamido-5-(diaminomethylideneamino)pentanoate;hydrochloride
InChIKeyHIXDELXKSSLIKB-UHFFFAOYSA-N
SMILESCCOC(=O)C(CCCN=C(N)N)NC(=O)C1=CC=CC=C1.Cl

Computed by PubChem (NCBI)