CAS 128851-36-5 is the registry number for M 16209. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[(3-bromo-1-benzofuran-2-yl)sulfonyl]imidazolidine-2,4-dione (CAS 128851-36-5) is a chemical compound with the molecular formula C11H7BrN2O5S and a molecular weight of 359.15 g/mol. IUPAC name: 1-[(3-bromo-1-benzofuran-2-yl)sulfonyl]imidazolidine-2,4-dione. InChIKey: ZJSUDHQFSBHLDV-UHFFFAOYSA-N.
| Molecular formula | C11H7BrN2O5S |
|---|---|
| Molecular weight | 359.15 g/mol |
| IUPAC name | 1-[(3-bromo-1-benzofuran-2-yl)sulfonyl]imidazolidine-2,4-dione |
| InChIKey | ZJSUDHQFSBHLDV-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(=O)N1S(=O)(=O)C2=C(C3=CC=CC=C3O2)Br |
Computed by PubChem (NCBI)