Products 1289025-40-6

CAS 1289025-40-6 is the registry number for Sorafenib tosylate Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-chloro-N-methylpyridine-3-carboxamide (CAS 1289025-40-6) is a chemical compound with the molecular formula C7H7ClN2O and a molecular weight of 170.59 g/mol. IUPAC name: 5-chloro-N-methylpyridine-3-carboxamide. InChIKey: YEHPCZRAEGAJNS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7ClN2O
Molecular weight170.59 g/mol
IUPAC name5-chloro-N-methylpyridine-3-carboxamide
InChIKeyYEHPCZRAEGAJNS-UHFFFAOYSA-N
SMILESCNC(=O)C1=CC(=CN=C1)Cl

Computed by PubChem (NCBI)