Products 1289102-69-7

CAS 1289102-69-7 is the registry number for 5-Fluoro-4-formylnicotinic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-fluoro-4-formylpyridine-3-carboxylic acid (CAS 1289102-69-7) is a chemical compound with the molecular formula C7H4FNO3 and a molecular weight of 169.11 g/mol. IUPAC name: 5-fluoro-4-formylpyridine-3-carboxylic acid. InChIKey: XNLCQDKFEGWFCE-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4FNO3
Molecular weight169.11 g/mol
IUPAC name5-fluoro-4-formylpyridine-3-carboxylic acid
InChIKeyXNLCQDKFEGWFCE-UHFFFAOYSA-N
SMILESC1=C(C(=C(C=N1)F)C=O)C(=O)O

Computed by PubChem (NCBI)