CAS 1289114-02-8 is the registry number for 3-Fluoro-5-nitropicolinaldehyde, 97%. Offered by: AmBeed. Available pack sizes: 1g.
3-fluoro-5-nitropyridine-2-carbaldehyde (CAS 1289114-02-8) is a chemical compound with the molecular formula C6H3FN2O3 and a molecular weight of 170.10 g/mol. IUPAC name: 3-fluoro-5-nitropyridine-2-carbaldehyde. InChIKey: BWQDJMUABOFWKT-UHFFFAOYSA-N.
| Molecular formula | C6H3FN2O3 |
|---|---|
| Molecular weight | 170.10 g/mol |
| IUPAC name | 3-fluoro-5-nitropyridine-2-carbaldehyde |
| InChIKey | BWQDJMUABOFWKT-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1F)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)