Products 1289160-67-3
CAS 1289160-67-3 appears in our catalog under these names: 2-Chloro-6-isopropylnicotinaldehyde, 95%, 2-Chloro-6-isopropylnicotinaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-chloro-6-propan-2-ylpyridine-3-carbaldehyde (CAS 1289160-67-3) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: 2-chloro-6-propan-2-ylpyridine-3-carbaldehyde. InChIKey: XLCILDNPJUGCQI-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | 2-chloro-6-propan-2-ylpyridine-3-carbaldehyde |
| InChIKey | XLCILDNPJUGCQI-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=C(C=C1)C=O)Cl |
Computed by PubChem (NCBI)