Products 1289261-79-5
CAS 1289261-79-5 appears in our catalog under these names: 8-Bromo-3-chloroimidazo[1,2-a]pyridine, 97%, 8-Bromo-3-chloroimidazo(1,2-a)pyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g.
8-bromo-3-chloroimidazo[1,2-a]pyridine (CAS 1289261-79-5) is a chemical compound with the molecular formula C7H4BrClN2 and a molecular weight of 231.48 g/mol. IUPAC name: 8-bromo-3-chloroimidazo[1,2-a]pyridine. InChIKey: XLHWMZZORNUXBP-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2 |
|---|---|
| Molecular weight | 231.48 g/mol |
| IUPAC name | 8-bromo-3-chloroimidazo[1,2-a]pyridine |
| InChIKey | XLHWMZZORNUXBP-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=CN=C2C(=C1)Br)Cl |
Computed by PubChem (NCBI)