Products 1289269-02-8

CAS 1289269-02-8 is the registry number for 3,5-Dichloro-4-(methylthio)pyridine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

3,5-dichloro-4-methylsulfanylpyridine (CAS 1289269-02-8) is a chemical compound with the molecular formula C6H5Cl2NS and a molecular weight of 194.08 g/mol. IUPAC name: 3,5-dichloro-4-methylsulfanylpyridine. InChIKey: ODLXFLUNUFVITB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5Cl2NS
Molecular weight194.08 g/mol
IUPAC name3,5-dichloro-4-methylsulfanylpyridine
InChIKeyODLXFLUNUFVITB-UHFFFAOYSA-N
SMILESCSC1=C(C=NC=C1Cl)Cl

Computed by PubChem (NCBI)