CAS 1289384-58-2 appears in our catalog under these names: (S)-2-(1-(TERT-BUTOXYCARBONYL)AZETIDIN-2-YL)ACETIC ACID, 97%, 2-[(2S)-1-[(tert-Butoxy)carbonyl]azetidin-2-yl]acetic acid, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
2-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-2-yl]acetic acid (CAS 1289384-58-2) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: 2-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-2-yl]acetic acid. InChIKey: TXLPFPLPMZEOQB-ZETCQYMHSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 2-[(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-2-yl]acetic acid |
| InChIKey | TXLPFPLPMZEOQB-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]1CC(=O)O |
Computed by PubChem (NCBI)