CAS 128942-39-2 appears in our catalog under these names: 7-Fluorochromone-2-carboxylic acid, 7-Fluoro-4-oxo-4H-chromene-2-carboxylic acid 98%, 7-Fluoro-4-oxo-4H-chromene-2-carboxylic acid, 98%, 98%, 7-Fluoro-4-oxo-4H-chromene-2-carboxylic acid, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 10g, 250mg, 1g, 5g.
7-fluoro-4-oxochromene-2-carboxylic acid (CAS 128942-39-2) is a chemical compound with the molecular formula C10H5FO4 and a molecular weight of 208.14 g/mol. IUPAC name: 7-fluoro-4-oxochromene-2-carboxylic acid. InChIKey: NOSMZQCJSBUIMM-UHFFFAOYSA-N.
| Molecular formula | C10H5FO4 |
|---|---|
| Molecular weight | 208.14 g/mol |
| IUPAC name | 7-fluoro-4-oxochromene-2-carboxylic acid |
| InChIKey | NOSMZQCJSBUIMM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)OC(=CC2=O)C(=O)O |
Computed by PubChem (NCBI)