CAS 1289555-51-6 appears in our catalog under these names: 2-Chloro-4-(thiophen-2-yl)pyridine, 95%, 2–Chloro–4–(thiophen–2–yl)pyridine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg.
2-chloro-4-thiophen-2-ylpyridine (CAS 1289555-51-6) is a chemical compound with the molecular formula C9H6ClNS and a molecular weight of 195.67 g/mol. IUPAC name: 2-chloro-4-thiophen-2-ylpyridine. InChIKey: WSDBIQZAFYFMGL-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNS |
|---|---|
| Molecular weight | 195.67 g/mol |
| IUPAC name | 2-chloro-4-thiophen-2-ylpyridine |
| InChIKey | WSDBIQZAFYFMGL-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=CC(=NC=C2)Cl |
Computed by PubChem (NCBI)