CAS 1289585-33-6 appears in our catalog under these names: (R)-tert-Butyl 3-((4-chlorophenyl)thio)pyrrolidine-1-carboxylate, 97%, 97%, (R)-3-(4-Chloro-phenylsulfanyl)-pyrrolidine-1-carboxylic acid tert-butyl ester, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg.
Tert-butyl (3R)-3-(4-chlorophenyl)sulfanylpyrrolidine-1-carboxylate (CAS 1289585-33-6) is a chemical compound with the molecular formula C15H20ClNO2S and a molecular weight of 313.8 g/mol. IUPAC name: tert-butyl (3R)-3-(4-chlorophenyl)sulfanylpyrrolidine-1-carboxylate. InChIKey: MEYYYYJAZMMAHH-CYBMUJFWSA-N.
| Molecular formula | C15H20ClNO2S |
|---|---|
| Molecular weight | 313.8 g/mol |
| IUPAC name | tert-butyl (3R)-3-(4-chlorophenyl)sulfanylpyrrolidine-1-carboxylate |
| InChIKey | MEYYYYJAZMMAHH-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)SC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)