CAS 1289646-72-5 is the registry number for Lifitegrast Impurity 26. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-2-trityl-3,4-dihydro-1H-isoquinoline (CAS 1289646-72-5) is a chemical compound with the molecular formula C28H23Cl2N and a molecular weight of 444.4 g/mol. IUPAC name: 5,7-dichloro-2-trityl-3,4-dihydro-1H-isoquinoline. InChIKey: GNJLKXCOYZKBEG-UHFFFAOYSA-N.
| Molecular formula | C28H23Cl2N |
|---|---|
| Molecular weight | 444.4 g/mol |
| IUPAC name | 5,7-dichloro-2-trityl-3,4-dihydro-1H-isoquinoline |
| InChIKey | GNJLKXCOYZKBEG-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=C1C(=CC(=C2)Cl)Cl)C(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)