CAS 1289646-78-1 is the registry number for Lifitegrast Impurity 59. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-methylsulfonylphenyl)propanoate (CAS 1289646-78-1) is a chemical compound with the molecular formula C22H27NO6S and a molecular weight of 433.5 g/mol. IUPAC name: benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-methylsulfonylphenyl)propanoate. InChIKey: PHBQFYLTLBWTNF-IBGZPJMESA-N.
| Molecular formula | C22H27NO6S |
|---|---|
| Molecular weight | 433.5 g/mol |
| IUPAC name | benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(3-methylsulfonylphenyl)propanoate |
| InChIKey | PHBQFYLTLBWTNF-IBGZPJMESA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=CC=C1)S(=O)(=O)C)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)