Products 1289689-32-2
CAS 1289689-32-2 is the registry number for (R)-tert-Butyl 3-methylpyrrolidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl (3R)-3-methylpyrrolidine-1-carboxylate (CAS 1289689-32-2) is a chemical compound with the molecular formula C10H19NO2 and a molecular weight of 185.26 g/mol. IUPAC name: tert-butyl (3R)-3-methylpyrrolidine-1-carboxylate. InChIKey: JQXFBJIDTLTFNU-MRVPVSSYSA-N.
| Molecular formula | C10H19NO2 |
|---|---|
| Molecular weight | 185.26 g/mol |
| IUPAC name | tert-butyl (3R)-3-methylpyrrolidine-1-carboxylate |
| InChIKey | JQXFBJIDTLTFNU-MRVPVSSYSA-N |
| SMILES | C[C@@H]1CCN(C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)