CAS 128996-90-7 is the registry number for (S)-3-Isobutylmorpholine-2,5-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-(2-methylpropyl)morpholine-2,5-dione (CAS 128996-90-7) is a chemical compound with the molecular formula C8H13NO3 and a molecular weight of 171.19 g/mol. IUPAC name: (3S)-3-(2-methylpropyl)morpholine-2,5-dione. InChIKey: XCJJDQSWJHACOM-LURJTMIESA-N.
| Molecular formula | C8H13NO3 |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | (3S)-3-(2-methylpropyl)morpholine-2,5-dione |
| InChIKey | XCJJDQSWJHACOM-LURJTMIESA-N |
| SMILES | CC(C)C[C@H]1C(=O)OCC(=O)N1 |
Computed by PubChem (NCBI)