CAS 129-09-9 appears in our catalog under these names: C.I.Vat Yellow 2 (Technical Grade), C.I. Vat Yellow 2/ 98%, Vat Yellow 2, C.I. Vat Yellow 2, C.I.Vat Yellow 2, min. 95 %, 500 mg. Offered by: TRC, TargetMol, Chemat, MedChemExpress, Roth. Available pack sizes: 2,5g, 250mg, 500mg, 10mg, 25mg, 50mg, 100mg, 10 mg.
6,16-diphenyl-5,15-dithia-7,17-diazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),3(11),4(8),6,9,14(18),16,19-octaene-2,12-dione (CAS 129-09-9) is a chemical compound with the molecular formula C28H14N2O2S2 and a molecular weight of 474.6 g/mol. IUPAC name: 6,16-diphenyl-5,15-dithia-7,17-diazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),3(11),4(8),6,9,14(18),16,19-octaene-2,12-dione. InChIKey: GFFQNEGBFFGLQG-UHFFFAOYSA-N.
| Molecular formula | C28H14N2O2S2 |
|---|---|
| Molecular weight | 474.6 g/mol |
| IUPAC name | 6,16-diphenyl-5,15-dithia-7,17-diazapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1(13),3(11),4(8),6,9,14(18),16,19-octaene-2,12-dione |
| InChIKey | GFFQNEGBFFGLQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(S2)C4=C(C=C3)C(=O)C5=C(C4=O)C=CC6=C5SC(=N6)C7=CC=CC=C7 |
Computed by PubChem (NCBI)