CAS 129-79-3 appears in our catalog under these names: 2,4,7-Trinitro-9-Fluorenone, 2,4,7-Trinitro-9-fluorenone 10 µg/mL in Cyclohexane. Offered by: Chemat Brand, Dr. Ehrenstorfer. Available pack sizes: on request, 10ml.
2,4,7-trinitrofluoren-9-one (CAS 129-79-3) is a chemical compound with the molecular formula C13H5N3O7 and a molecular weight of 315.19 g/mol. IUPAC name: 2,4,7-trinitrofluoren-9-one. InChIKey: VHQGURIJMFPBKS-UHFFFAOYSA-N.
| Molecular formula | C13H5N3O7 |
|---|---|
| Molecular weight | 315.19 g/mol |
| IUPAC name | 2,4,7-trinitrofluoren-9-one |
| InChIKey | VHQGURIJMFPBKS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C(=O)C3=C2C(=CC(=C3)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)