CAS 1290039-79-0 is the registry number for N-(4-Bromophenyl)-N-phenyl-[1,1':3',1''-terphenyl]-5'-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-bromophenyl)-N,3,5-triphenylaniline (CAS 1290039-79-0) is a chemical compound with the molecular formula C30H22BrN and a molecular weight of 476.4 g/mol. IUPAC name: N-(4-bromophenyl)-N,3,5-triphenylaniline. InChIKey: PUGHSPVHUWGRKQ-UHFFFAOYSA-N.
| Molecular formula | C30H22BrN |
|---|---|
| Molecular weight | 476.4 g/mol |
| IUPAC name | N-(4-bromophenyl)-N,3,5-triphenylaniline |
| InChIKey | PUGHSPVHUWGRKQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)N(C3=CC=CC=C3)C4=CC=C(C=C4)Br)C5=CC=CC=C5 |
Computed by PubChem (NCBI)