CAS 1961241-75-7 is the registry number for N-(4-Bromophenyl)-N-phenyl-[1,1':4',1''-terphenyl]-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-bromophenyl)-N-phenyl-4-(4-phenylphenyl)aniline (CAS 1961241-75-7) is a chemical compound with the molecular formula C30H22BrN and a molecular weight of 476.4 g/mol. IUPAC name: N-(4-bromophenyl)-N-phenyl-4-(4-phenylphenyl)aniline. InChIKey: KVAQFIPPBHFHBO-UHFFFAOYSA-N.
| Molecular formula | C30H22BrN |
|---|---|
| Molecular weight | 476.4 g/mol |
| IUPAC name | N-(4-bromophenyl)-N-phenyl-4-(4-phenylphenyl)aniline |
| InChIKey | KVAQFIPPBHFHBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)N(C4=CC=CC=C4)C5=CC=C(C=C5)Br |
Computed by PubChem (NCBI)