CAS 1290191-90-0 is the registry number for (3R,4S)-tert-Butyl 3-hydroxy-4-methylpyrrolidine-1-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl (3R,4S)-3-hydroxy-4-methylpyrrolidine-1-carboxylate (CAS 1290191-90-0) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl (3R,4S)-3-hydroxy-4-methylpyrrolidine-1-carboxylate. InChIKey: YMSRLPJZNWGMAM-YUMQZZPRSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl (3R,4S)-3-hydroxy-4-methylpyrrolidine-1-carboxylate |
| InChIKey | YMSRLPJZNWGMAM-YUMQZZPRSA-N |
| SMILES | C[C@H]1CN(C[C@@H]1O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)